C15H12BrF4N3O — CID 54314046
1-(4-bromo-2-fluoro-5-methylphenyl)-4-fluoro-8H-pyrimido[1,2-a]pyrimidin-2-one;difluoromethane (PubChem CID 54314046) has the molecular formula C15H12BrF4N3O and a molecular weight of 406.18 g/mol. Its IUPAC name is 1-(4-bromo-2-fluoro-5-methylphenyl)-4-fluoro-8H-pyrimido[1,2-a]pyrimidin-2-one;difluoromethane.
| Compound Name | 1-(4-bromo-2-fluoro-5-methylphenyl)-4-fluoro-8H-pyrimido[1,2-a]pyrimidin-2-one;difluoromethane |
|---|---|
| PubChem CID | 54314046 |
| Molecular Formula | C15H12BrF4N3O |
| Molecular Weight | 406.18 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 1-(4-bromo-2-fluoro-5-methylphenyl)-4-fluoro-8H-pyrimido[1,2-a]pyrimidin-2-one;difluoromethane |
| SMILES | Cc1cc(N2C(=O)C=C(F)N3C=CCN=C32)c(F)cc1Br.FCF |
| InChI | InChI=1S/C14H10BrF2N3O.CH2F2/c1-8-5-11(10(16)6-9(8)15)20-13(21)7-12(17)19-4-2-3-18-14(19)20;2-1-3/h2,4-7H,3H2,1H3;1H2 |
| InChIKey | SMXCNPHIEXMGTI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.18 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|