C10H6BrF2NO2S — CID 107612783
4-(4-bromo-2,5-difluorophenyl)thiomorpholine-3,5-dione (PubChem CID 107612783) has the molecular formula C10H6BrF2NO2S and a molecular weight of 322.13 g/mol. Its IUPAC name is 4-(4-bromo-2,5-difluorophenyl)thiomorpholine-3,5-dione.
| Compound Name | 4-(4-bromo-2,5-difluorophenyl)thiomorpholine-3,5-dione |
|---|---|
| PubChem CID | 107612783 |
| Molecular Formula | C10H6BrF2NO2S |
| Molecular Weight | 322.13 g/mol |
| Exact Mass | 320.93 |
| IUPAC Name | 4-(4-bromo-2,5-difluorophenyl)thiomorpholine-3,5-dione |
| SMILES | O=C1CSCC(=O)N1c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C10H6BrF2NO2S/c11-5-1-7(13)8(2-6(5)12)14-9(15)3-17-4-10(14)16/h1-2H,3-4H2 |
| InChIKey | DUVFFPZCVINVIS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.13 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|