C13H9ClF3N3O — CID 54573021
8-(4-chloro-2,6-difluoro-3-methylphenyl)-5-fluoro-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one (PubChem CID 54573021) has the molecular formula C13H9ClF3N3O and a molecular weight of 315.68 g/mol. Its IUPAC name is 8-(4-chloro-2,6-difluoro-3-methylphenyl)-5-fluoro-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one.
| Compound Name | 8-(4-chloro-2,6-difluoro-3-methylphenyl)-5-fluoro-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 54573021 |
| Molecular Formula | C13H9ClF3N3O |
| Molecular Weight | 315.68 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 8-(4-chloro-2,6-difluoro-3-methylphenyl)-5-fluoro-2,3-dihydroimidazo[1,2-a]pyrimidin-7-one |
| SMILES | Cc1c(Cl)cc(F)c(N2C(=O)C=C(F)N3CCN=C32)c1F |
| InChI | InChI=1S/C13H9ClF3N3O/c1-6-7(14)4-8(15)12(11(6)17)20-10(21)5-9(16)19-3-2-18-13(19)20/h4-5H,2-3H2,1H3 |
| InChIKey | FATLTJGMCPHBAS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.68 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|