C26H25Cl2FN8O2 — CID 139503274
7-(2,6-dichlorophenyl)-12-[3-fluoro-5-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one (PubChem CID 139503274) has the molecular formula C26H25Cl2FN8O2 and a molecular weight of 571.44 g/mol. Its IUPAC name is 7-(2,6-dichlorophenyl)-12-[3-fluoro-5-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one.
| Compound Name | 7-(2,6-dichlorophenyl)-12-[3-fluoro-5-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one |
|---|---|
| PubChem CID | 139503274 |
| Molecular Formula | C26H25Cl2FN8O2 |
| Molecular Weight | 571.44 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 7-(2,6-dichlorophenyl)-12-[3-fluoro-5-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one |
| SMILES | COc1cc(Nc2ncc3c(n2)N2CCN=C2N(c2c(Cl)cccc2Cl)C3=O)cc(F)c1N1CCN(C)CC1 |
| InChI | InChI=1S/C26H25Cl2FN8O2/c1-34-8-10-35(11-9-34)22-19(29)12-15(13-20(22)39-2)32-25-31-14-16-23(33-25)36-7-6-30-26(36)37(24(16)38)21-17(27)4-3-5-18(21)28/h3-5,12-14H,6-11H2,1-2H3,(H,31,32,33) |
| InChIKey | DUPIGIMVTDVMPV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|