C29H34N8O — CID 139503259
7-(2,6-dimethylphenyl)-12-[4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]anilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one (PubChem CID 139503259) has the molecular formula C29H34N8O and a molecular weight of 510.65 g/mol. Its IUPAC name is 7-(2,6-dimethylphenyl)-12-[4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]anilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one.
| Compound Name | 7-(2,6-dimethylphenyl)-12-[4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]anilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one |
|---|---|
| PubChem CID | 139503259 |
| Molecular Formula | C29H34N8O |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 7-(2,6-dimethylphenyl)-12-[4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]anilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one |
| SMILES | Cc1cccc(C)c1N1C(=O)c2cnc(Nc3ccc(N4C[C@@H](C)N(C)[C@@H](C)C4)cc3)nc2N2CCN=C21 |
| InChI | InChI=1S/C29H34N8O/c1-18-7-6-8-19(2)25(18)37-27(38)24-15-31-28(33-26(24)36-14-13-30-29(36)37)32-22-9-11-23(12-10-22)35-16-20(3)34(5)21(4)17-35/h6-12,15,20-21H,13-14,16-17H2,1-5H3,(H,31,32,33)/t20-,21+ |
| InChIKey | WGSAHHRFRWERFG-OYRHEFFESA-N |
| XLogP | 4.20 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|