C25H22Cl3FN8O — CID 139503297
12-[3-chloro-5-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7-(2,6-dichlorophenyl)-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one (PubChem CID 139503297) has the molecular formula C25H22Cl3FN8O and a molecular weight of 575.86 g/mol. Its IUPAC name is 12-[3-chloro-5-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7-(2,6-dichlorophenyl)-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one.
| Compound Name | 12-[3-chloro-5-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7-(2,6-dichlorophenyl)-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one |
|---|---|
| PubChem CID | 139503297 |
| Molecular Formula | C25H22Cl3FN8O |
| Molecular Weight | 575.86 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | 12-[3-chloro-5-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7-(2,6-dichlorophenyl)-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one |
| SMILES | CN1CCN(c2c(F)cc(Nc3ncc4c(n3)N3CCN=C3N(c3c(Cl)cccc3Cl)C4=O)cc2Cl)CC1 |
| InChI | InChI=1S/C25H22Cl3FN8O/c1-34-7-9-35(10-8-34)21-18(28)11-14(12-19(21)29)32-24-31-13-15-22(33-24)36-6-5-30-25(36)37(23(15)38)20-16(26)3-2-4-17(20)27/h2-4,11-13H,5-10H2,1H3,(H,31,32,33) |
| InChIKey | QALRZSBKDLIEKL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.86 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|