C28H29ClF2N8O — CID 139503346
7-(2-chloro-6-fluorophenyl)-12-[4-[4-(dimethylamino)piperidin-1-yl]-3-fluoro-5-methylanilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one (PubChem CID 139503346) has the molecular formula C28H29ClF2N8O and a molecular weight of 567.04 g/mol. Its IUPAC name is 7-(2-chloro-6-fluorophenyl)-12-[4-[4-(dimethylamino)piperidin-1-yl]-3-fluoro-5-methylanilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one.
| Compound Name | 7-(2-chloro-6-fluorophenyl)-12-[4-[4-(dimethylamino)piperidin-1-yl]-3-fluoro-5-methylanilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one |
|---|---|
| PubChem CID | 139503346 |
| Molecular Formula | C28H29ClF2N8O |
| Molecular Weight | 567.04 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | 7-(2-chloro-6-fluorophenyl)-12-[4-[4-(dimethylamino)piperidin-1-yl]-3-fluoro-5-methylanilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one |
| SMILES | Cc1cc(Nc2ncc3c(n2)N2CCN=C2N(c2c(F)cccc2Cl)C3=O)cc(F)c1N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C28H29ClF2N8O/c1-16-13-17(14-22(31)23(16)37-10-7-18(8-11-37)36(2)3)34-27-33-15-19-25(35-27)38-12-9-32-28(38)39(26(19)40)24-20(29)5-4-6-21(24)30/h4-6,13-15,18H,7-12H2,1-3H3,(H,33,34,35) |
| InChIKey | VAHNAXJQFIGXOF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.04 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|