C27H27Cl2FN8O — CID 139503253
7-(2-chloro-6-fluorophenyl)-12-[3-chloro-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]anilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one (PubChem CID 139503253) has the molecular formula C27H27Cl2FN8O and a molecular weight of 569.47 g/mol. Its IUPAC name is 7-(2-chloro-6-fluorophenyl)-12-[3-chloro-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]anilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one.
| Compound Name | 7-(2-chloro-6-fluorophenyl)-12-[3-chloro-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]anilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one |
|---|---|
| PubChem CID | 139503253 |
| Molecular Formula | C27H27Cl2FN8O |
| Molecular Weight | 569.47 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | 7-(2-chloro-6-fluorophenyl)-12-[3-chloro-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]anilino]-2,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),5,9,11-tetraen-8-one |
| SMILES | C[C@@H]1CN(c2ccc(Nc3ncc4c(n3)N3CCN=C3N(c3c(F)cccc3Cl)C4=O)cc2Cl)C[C@H](C)N1C |
| InChI | InChI=1S/C27H27Cl2FN8O/c1-15-13-36(14-16(2)35(15)3)22-8-7-17(11-20(22)29)33-26-32-12-18-24(34-26)37-10-9-31-27(37)38(25(18)39)23-19(28)5-4-6-21(23)30/h4-8,11-12,15-16H,9-10,13-14H2,1-3H3,(H,32,33,34)/t15-,16+ |
| InChIKey | MQAKLTYVTRLQBP-IYBDPMFKSA-N |
| XLogP | 5.03 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|