C40H51F3O7 — CID 54316402
[(2R,3R,6R)-6-hexoxy-2-(trifluoromethyl)oxan-3-yl] 6-(4-decoxyphenyl)-1-formyloxynaphthalene-2-carboxylate (PubChem CID 54316402) has the molecular formula C40H51F3O7 and a molecular weight of 700.84 g/mol. Its IUPAC name is [(2R,3R,6R)-6-hexoxy-2-(trifluoromethyl)oxan-3-yl] 6-(4-decoxyphenyl)-1-formyloxynaphthalene-2-carboxylate.
| Compound Name | [(2R,3R,6R)-6-hexoxy-2-(trifluoromethyl)oxan-3-yl] 6-(4-decoxyphenyl)-1-formyloxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 54316402 |
| Molecular Formula | C40H51F3O7 |
| Molecular Weight | 700.84 g/mol |
| Exact Mass | 700.36 |
| IUPAC Name | [(2R,3R,6R)-6-hexoxy-2-(trifluoromethyl)oxan-3-yl] 6-(4-decoxyphenyl)-1-formyloxynaphthalene-2-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc3c(OC=O)c(C(=O)O[C@@H]4CC[C@H](OCCCCCC)O[C@H]4C(F)(F)F)ccc3c2)cc1 |
| InChI | InChI=1S/C40H51F3O7/c1-3-5-7-9-10-11-12-14-25-46-32-19-15-29(16-20-32)30-17-21-33-31(27-30)18-22-34(37(33)48-28-44)39(45)49-35-23-24-36(47-26-13-8-6-4-2)50-38(35)40(41,42)43/h15-22,27-28,35-36,38H,3-14,23-26H2,1-2H3/t35-,36-,38-/m1/s1 |
| InChIKey | SOMPPKXFVMZOHE-UTTKADLYSA-N |
| XLogP | 10.75 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.84 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|