C15H17I2NO4S2 — CID 54318637
ethyl 5-[carbamothioylsulfonyl(diiodo)methyl]-1,2,3,4-tetrahydronaphthalene-1-carboxylate (PubChem CID 54318637) has the molecular formula C15H17I2NO4S2 and a molecular weight of 593.25 g/mol. Its IUPAC name is ethyl 5-[carbamothioylsulfonyl(diiodo)methyl]-1,2,3,4-tetrahydronaphthalene-1-carboxylate.
| Compound Name | ethyl 5-[carbamothioylsulfonyl(diiodo)methyl]-1,2,3,4-tetrahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 54318637 |
| Molecular Formula | C15H17I2NO4S2 |
| Molecular Weight | 593.25 g/mol |
| Exact Mass | 592.87 |
| IUPAC Name | ethyl 5-[carbamothioylsulfonyl(diiodo)methyl]-1,2,3,4-tetrahydronaphthalene-1-carboxylate |
| SMILES | CCOC(=O)C1CCCc2c1cccc2C(I)(I)S(=O)(=O)C(N)=S |
| InChI | InChI=1S/C15H17I2NO4S2/c1-2-22-13(19)11-7-3-6-10-9(11)5-4-8-12(10)15(16,17)24(20,21)14(18)23/h4-5,8,11H,2-3,6-7H2,1H3,(H2,18,23) |
| InChIKey | SQANTPBUDDYDKU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|