C11H15N5O2S — CID 54318670
1-cyano-3-[2-[(3-hydroxy-2-pyridinyl)methylsulfinyl]ethyl]-2-methylguanidine (PubChem CID 54318670) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 1-cyano-3-[2-[(3-hydroxy-2-pyridinyl)methylsulfinyl]ethyl]-2-methylguanidine.
| Compound Name | 1-cyano-3-[2-[(3-hydroxy-2-pyridinyl)methylsulfinyl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 54318670 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 1-cyano-3-[2-[(3-hydroxy-2-pyridinyl)methylsulfinyl]ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCCS(=O)Cc1ncccc1O |
| InChI | InChI=1S/C11H15N5O2S/c1-13-11(16-8-12)15-5-6-19(18)7-9-10(17)3-2-4-14-9/h2-4,17H,5-7H2,1H3,(H2,13,15,16) |
| InChIKey | SQAZTMIOYCAKPP-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|