C24H30O4 — CID 54321309
(3aR,5R,6S,6aR)-5-butyl-6-[(2,6-dimethylphenyl)methoxy]-2-phenyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 54321309) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-butyl-6-[(2,6-dimethylphenyl)methoxy]-2-phenyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-butyl-6-[(2,6-dimethylphenyl)methoxy]-2-phenyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 54321309 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-butyl-6-[(2,6-dimethylphenyl)methoxy]-2-phenyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCCC[C@H]1O[C@@H]2OC(c3ccccc3)O[C@@H]2[C@H]1OCc1c(C)cccc1C |
| InChI | InChI=1S/C24H30O4/c1-4-5-14-20-21(25-15-19-16(2)10-9-11-17(19)3)22-24(26-20)28-23(27-22)18-12-7-6-8-13-18/h6-13,20-24H,4-5,14-15H2,1-3H3/t20-,21+,22-,23?,24-/m1/s1 |
| InChIKey | SRWHGPQAZCUVFI-ZVFPPSPPSA-N |
| XLogP | 5.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |