C24H35F3O4 — CID 22825492
(3aR,5R,6S,6aR)-2,5-dibutyl-2-propyl-6-[[2-(trifluoromethyl)phenyl]methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 22825492) has the molecular formula C24H35F3O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2,5-dibutyl-2-propyl-6-[[2-(trifluoromethyl)phenyl]methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-2,5-dibutyl-2-propyl-6-[[2-(trifluoromethyl)phenyl]methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 22825492 |
| Molecular Formula | C24H35F3O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (3aR,5R,6S,6aR)-2,5-dibutyl-2-propyl-6-[[2-(trifluoromethyl)phenyl]methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCCC[C@H]1O[C@@H]2OC(CCC)(CCCC)O[C@@H]2[C@H]1OCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H35F3O4/c1-4-7-13-19-20(28-16-17-11-9-10-12-18(17)24(25,26)27)21-22(29-19)31-23(30-21,14-6-3)15-8-5-2/h9-12,19-22H,4-8,13-16H2,1-3H3/t19-,20+,21-,22-,23?/m1/s1 |
| InChIKey | CNIVKOYYVPBKGT-HOJNNBGMSA-N |
| XLogP | 6.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |