C4H5NO2 — CID 54325138
2-methyl-1,3-oxazol-4-ol (PubChem CID 54325138) has the molecular formula C4H5NO2 and a molecular weight of 99.09 g/mol. Its IUPAC name is 2-methyl-1,3-oxazol-4-ol.
| Compound Name | 2-methyl-1,3-oxazol-4-ol |
|---|---|
| PubChem CID | 54325138 |
| Molecular Formula | C4H5NO2 |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.03 |
| IUPAC Name | 2-methyl-1,3-oxazol-4-ol |
| SMILES | Cc1nc(O)co1 |
| InChI | InChI=1S/C4H5NO2/c1-3-5-4(6)2-7-3/h2,6H,1H3 |
| InChIKey | SUJOXDGDLGETPR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |