C23H34NO3S- — CID 54331814
N,4-dimethylaniline;2-methoxy-5-(2,4,4-trimethylpentan-2-yl)benzenesulfinate (PubChem CID 54331814) has the molecular formula C23H34NO3S- and a molecular weight of 404.60 g/mol. Its IUPAC name is N,4-dimethylaniline;2-methoxy-5-(2,4,4-trimethylpentan-2-yl)benzenesulfinate.
| Compound Name | N,4-dimethylaniline;2-methoxy-5-(2,4,4-trimethylpentan-2-yl)benzenesulfinate |
|---|---|
| PubChem CID | 54331814 |
| Molecular Formula | C23H34NO3S- |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N,4-dimethylaniline;2-methoxy-5-(2,4,4-trimethylpentan-2-yl)benzenesulfinate |
| SMILES | CNc1ccc(C)cc1.COc1ccc(C(C)(C)CC(C)(C)C)cc1S(=O)[O-] |
| InChI | InChI=1S/C15H24O3S.C8H11N/c1-14(2,3)10-15(4,5)11-7-8-12(18-6)13(9-11)19(16)17;1-7-3-5-8(9-2)6-4-7/h7-9H,10H2,1-6H3,(H,16,17);3-6,9H,1-2H3/p-1 |
| InChIKey | DKNAUGFUHPTHGU-UHFFFAOYSA-M |
| XLogP | 5.68 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|