C12H10N2 — CID 54333687
1-naphthalen-1-ylethane-1,2-diimine (PubChem CID 54333687) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 1-naphthalen-1-ylethane-1,2-diimine.
| Compound Name | 1-naphthalen-1-ylethane-1,2-diimine |
|---|---|
| PubChem CID | 54333687 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 1-naphthalen-1-ylethane-1,2-diimine |
| SMILES | [H]/N=C(\C=N\[H])c1cccc2ccccc12 |
| InChI | InChI=1S/C12H10N2/c13-8-12(14)11-7-3-5-9-4-1-2-6-10(9)11/h1-8,13-14H/b13-8+,14-12+ |
| InChIKey | TTYFMIACFALPJI-LMLHBTEYSA-N |
| XLogP | 2.86 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|