C17H25N3O4S — CID 54336549
ethyl 4-[cyclopropyl-(3-ethoxy-3-oxopropyl)amino]-2-ethylsulfanylpyrimidine-5-carboxylate (PubChem CID 54336549) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is ethyl 4-[cyclopropyl-(3-ethoxy-3-oxopropyl)amino]-2-ethylsulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[cyclopropyl-(3-ethoxy-3-oxopropyl)amino]-2-ethylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 54336549 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | ethyl 4-[cyclopropyl-(3-ethoxy-3-oxopropyl)amino]-2-ethylsulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)CCN(c1nc(SCC)ncc1C(=O)OCC)C1CC1 |
| InChI | InChI=1S/C17H25N3O4S/c1-4-23-14(21)9-10-20(12-7-8-12)15-13(16(22)24-5-2)11-18-17(19-15)25-6-3/h11-12H,4-10H2,1-3H3 |
| InChIKey | TVWOMUMSKULHNF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |