C29H28N4O6S — CID 54344221
benzhydryl 2-[4-[3-[(4-cyanophenyl)sulfonylamino]propyl]-2,3-dioxopiperazin-1-yl]acetate (PubChem CID 54344221) has the molecular formula C29H28N4O6S and a molecular weight of 560.63 g/mol. Its IUPAC name is benzhydryl 2-[4-[3-[(4-cyanophenyl)sulfonylamino]propyl]-2,3-dioxopiperazin-1-yl]acetate.
| Compound Name | benzhydryl 2-[4-[3-[(4-cyanophenyl)sulfonylamino]propyl]-2,3-dioxopiperazin-1-yl]acetate |
|---|---|
| PubChem CID | 54344221 |
| Molecular Formula | C29H28N4O6S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | benzhydryl 2-[4-[3-[(4-cyanophenyl)sulfonylamino]propyl]-2,3-dioxopiperazin-1-yl]acetate |
| SMILES | N#Cc1ccc(S(=O)(=O)NCCCN2CCN(CC(=O)OC(c3ccccc3)c3ccccc3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C29H28N4O6S/c30-20-22-12-14-25(15-13-22)40(37,38)31-16-7-17-32-18-19-33(29(36)28(32)35)21-26(34)39-27(23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-6,8-15,27,31H,7,16-19,21H2 |
| InChIKey | UBDFDNXWFHKSEA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 136.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|