C15H23NO4S — CID 54345555
diethyl 2-(dimethylamino)-5-prop-2-enylsulfanylhexa-2,4-dienedioate (PubChem CID 54345555) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is diethyl 2-(dimethylamino)-5-prop-2-enylsulfanylhexa-2,4-dienedioate.
| Compound Name | diethyl 2-(dimethylamino)-5-prop-2-enylsulfanylhexa-2,4-dienedioate |
|---|---|
| PubChem CID | 54345555 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | diethyl 2-(dimethylamino)-5-prop-2-enylsulfanylhexa-2,4-dienedioate |
| SMILES | C=CCSC(=CC=C(C(=O)OCC)N(C)C)C(=O)OCC |
| InChI | InChI=1S/C15H23NO4S/c1-6-11-21-13(15(18)20-8-3)10-9-12(16(4)5)14(17)19-7-2/h6,9-10H,1,7-8,11H2,2-5H3 |
| InChIKey | UCBSMOVLNZTUJS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|