C20H27NO4S — CID 88607973
diethyl (2Z,4Z)-2-(dimethylamino)-5-[(4-methylphenyl)methylsulfanyl]hexa-2,4-dienedioate (PubChem CID 88607973) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is diethyl (2Z,4Z)-2-(dimethylamino)-5-[(4-methylphenyl)methylsulfanyl]hexa-2,4-dienedioate.
| Compound Name | diethyl (2Z,4Z)-2-(dimethylamino)-5-[(4-methylphenyl)methylsulfanyl]hexa-2,4-dienedioate |
|---|---|
| PubChem CID | 88607973 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | diethyl (2Z,4Z)-2-(dimethylamino)-5-[(4-methylphenyl)methylsulfanyl]hexa-2,4-dienedioate |
| SMILES | CCOC(=O)/C(=C/C=C(/C(=O)OCC)N(C)C)SCc1ccc(C)cc1 |
| InChI | InChI=1S/C20H27NO4S/c1-6-24-19(22)17(21(4)5)12-13-18(20(23)25-7-2)26-14-16-10-8-15(3)9-11-16/h8-13H,6-7,14H2,1-5H3/b17-12-,18-13- |
| InChIKey | GNSUTCMSPBDHPZ-MZGHLJKDSA-N |
| XLogP | 3.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|