About ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid
ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid (PubChem CID 175987260) has the molecular formula C14H27NO5
and a molecular weight of 289.37 g/mol. Its IUPAC name is ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid.
Molecular Properties
| Compound Name | ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid |
| PubChem CID | 175987260 |
| Molecular Formula | C14H27NO5 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid |
| SMILES | C=C(C(=O)OCC)N(C)C.C=CC(=O)O.CCOCC |
| InChI | InChI=1S/C7H13NO2.C4H10O.C3H4O2/c1-5-10-7(9)6(2)8(3)4;1-3-5-4-2;1-2-3(4)5/h2,5H2,1,3-4H3;3-4H2,1-2H3;2H,1H2,(H,4,5) |
| InChIKey | PFGDASBKUUHTKO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid?
The IUPAC name of ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid (CID 175987260) is ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid.
What is the SMILES notation for ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid?
The canonical SMILES for ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid is C=C(C(=O)OCC)N(C)C.C=CC(=O)O.CCOCC.
What is the InChIKey of ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid?
The InChIKey is PFGDASBKUUHTKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C4H10O.C3H4O2/c1-5-10-7(9)6(2)8(3)4;1-3-5-4-2;1-2-3(4)5/h2,5H2,1,3-4H3;3-4H2,1-2H3;2H,1H2,(H,4,5).
What are the key properties of ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid?
ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid has a molecular weight of 289.37 g/mol, XLogP of 1.92, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;ethyl 2-(dimethylamino)prop-2-enoate;prop-2-enoic acid is sourced from PubChem (CID 175987260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).