C36H31NO5S — CID 54346173
4-[2-methyl-2-[4-oxo-5,7-bis(phenylmethoxy)-2,3-dihydrochromen-2-yl]propylidene]-2-phenyl-1,3-thiazol-5-one (PubChem CID 54346173) has the molecular formula C36H31NO5S and a molecular weight of 589.71 g/mol. Its IUPAC name is 4-[2-methyl-2-[4-oxo-5,7-bis(phenylmethoxy)-2,3-dihydrochromen-2-yl]propylidene]-2-phenyl-1,3-thiazol-5-one.
| Compound Name | 4-[2-methyl-2-[4-oxo-5,7-bis(phenylmethoxy)-2,3-dihydrochromen-2-yl]propylidene]-2-phenyl-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 54346173 |
| Molecular Formula | C36H31NO5S |
| Molecular Weight | 589.71 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | 4-[2-methyl-2-[4-oxo-5,7-bis(phenylmethoxy)-2,3-dihydrochromen-2-yl]propylidene]-2-phenyl-1,3-thiazol-5-one |
| SMILES | CC(C)(C=C1N=C(c2ccccc2)SC1=O)C1CC(=O)c2c(OCc3ccccc3)cc(OCc3ccccc3)cc2O1 |
| InChI | InChI=1S/C36H31NO5S/c1-36(2,21-28-35(39)43-34(37-28)26-16-10-5-11-17-26)32-20-29(38)33-30(41-23-25-14-8-4-9-15-25)18-27(19-31(33)42-32)40-22-24-12-6-3-7-13-24/h3-19,21,32H,20,22-23H2,1-2H3 |
| InChIKey | UCLPHMDKJQQQFV-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.71 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|