C20H18ClFN4O — CID 54348508
2-[3-[(2-chloro-6-fluorophenyl)methoxy]-2-pyridinyl]-1-methyl-1-phenylguanidine (PubChem CID 54348508) has the molecular formula C20H18ClFN4O and a molecular weight of 384.84 g/mol. Its IUPAC name is 2-[3-[(2-chloro-6-fluorophenyl)methoxy]-2-pyridinyl]-1-methyl-1-phenylguanidine.
| Compound Name | 2-[3-[(2-chloro-6-fluorophenyl)methoxy]-2-pyridinyl]-1-methyl-1-phenylguanidine |
|---|---|
| PubChem CID | 54348508 |
| Molecular Formula | C20H18ClFN4O |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-[3-[(2-chloro-6-fluorophenyl)methoxy]-2-pyridinyl]-1-methyl-1-phenylguanidine |
| SMILES | CN(C(N)=Nc1ncccc1OCc1c(F)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C20H18ClFN4O/c1-26(14-7-3-2-4-8-14)20(23)25-19-18(11-6-12-24-19)27-13-15-16(21)9-5-10-17(15)22/h2-12H,13H2,1H3,(H2,23,24,25) |
| InChIKey | UDZUPVNJPXVVBI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|