C20H18Cl3N3O — CID 67780801
N'-[3-[(2,4-dichlorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide;hydrochloride (PubChem CID 67780801) has the molecular formula C20H18Cl3N3O and a molecular weight of 422.74 g/mol. Its IUPAC name is N'-[3-[(2,4-dichlorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide;hydrochloride.
| Compound Name | N'-[3-[(2,4-dichlorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 67780801 |
| Molecular Formula | C20H18Cl3N3O |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | N'-[3-[(2,4-dichlorophenyl)methoxy]-2-pyridinyl]-2-phenylethanimidamide;hydrochloride |
| SMILES | Cl.NC(Cc1ccccc1)=Nc1ncccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H17Cl2N3O.ClH/c21-16-9-8-15(17(22)12-16)13-26-18-7-4-10-24-20(18)25-19(23)11-14-5-2-1-3-6-14;/h1-10,12H,11,13H2,(H2,23,24,25);1H |
| InChIKey | IXJLNJKXSQXQEK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|