C56H94O2S2 — CID 54348803
1-O,11-O-bis(2-tert-butyl-5-methylphenyl) 4,8-diethyl-5,7-dioctyl-6-propylundecanebis(thioate) (PubChem CID 54348803) has the molecular formula C56H94O2S2 and a molecular weight of 863.50 g/mol. Its IUPAC name is 1-O,11-O-bis(2-tert-butyl-5-methylphenyl) 4,8-diethyl-5,7-dioctyl-6-propylundecanebis(thioate).
| Compound Name | 1-O,11-O-bis(2-tert-butyl-5-methylphenyl) 4,8-diethyl-5,7-dioctyl-6-propylundecanebis(thioate) |
|---|---|
| PubChem CID | 54348803 |
| Molecular Formula | C56H94O2S2 |
| Molecular Weight | 863.50 g/mol |
| Exact Mass | 862.67 |
| IUPAC Name | 1-O,11-O-bis(2-tert-butyl-5-methylphenyl) 4,8-diethyl-5,7-dioctyl-6-propylundecanebis(thioate) |
| SMILES | CCCCCCCCC(C(CC)CCC(=S)Oc1cc(C)ccc1C(C)(C)C)C(CCC)C(CCCCCCCC)C(CC)CCC(=S)Oc1cc(C)ccc1C(C)(C)C |
| InChI | InChI=1S/C56H94O2S2/c1-14-19-21-23-25-27-30-46(44(17-4)34-38-53(59)57-51-40-42(6)32-36-49(51)55(8,9)10)48(29-16-3)47(31-28-26-24-22-20-15-2)45(18-5)35-39-54(60)58-52-41-43(7)33-37-50(52)56(11,12)13/h32-33,36-37,40-41,44-48H,14-31,34-35,38-39H2,1-13H3 |
| InChIKey | UEFFBKQNXXDRDM-UHFFFAOYSA-N |
| XLogP | 18.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.50 |
| LogP ≤ 5 | 18.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|