C37H26N4O7 — CID 54359189
1,1-bis(2-hydroxy-4-nitrophenyl)-3,3-bis(2-phenylphenyl)urea (PubChem CID 54359189) has the molecular formula C37H26N4O7 and a molecular weight of 638.64 g/mol. Its IUPAC name is 1,1-bis(2-hydroxy-4-nitrophenyl)-3,3-bis(2-phenylphenyl)urea.
| Compound Name | 1,1-bis(2-hydroxy-4-nitrophenyl)-3,3-bis(2-phenylphenyl)urea |
|---|---|
| PubChem CID | 54359189 |
| Molecular Formula | C37H26N4O7 |
| Molecular Weight | 638.64 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | 1,1-bis(2-hydroxy-4-nitrophenyl)-3,3-bis(2-phenylphenyl)urea |
| SMILES | O=C(N(c1ccc([N+](=O)[O-])cc1O)c1ccc([N+](=O)[O-])cc1O)N(c1ccccc1-c1ccccc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C37H26N4O7/c42-35-23-27(40(45)46)19-21-33(35)39(34-22-20-28(41(47)48)24-36(34)43)37(44)38(31-17-9-7-15-29(31)25-11-3-1-4-12-25)32-18-10-8-16-30(32)26-13-5-2-6-14-26/h1-24,42-43H |
| InChIKey | ULGUDXASKDQFOY-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.64 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|