C28H30N2O5 — CID 54362615
2-(2-methoxycarbonylanilino)-3-[4-[(1-phenylpyrrolidin-2-yl)methoxy]phenyl]propanoic acid (PubChem CID 54362615) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-(2-methoxycarbonylanilino)-3-[4-[(1-phenylpyrrolidin-2-yl)methoxy]phenyl]propanoic acid.
| Compound Name | 2-(2-methoxycarbonylanilino)-3-[4-[(1-phenylpyrrolidin-2-yl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 54362615 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 2-(2-methoxycarbonylanilino)-3-[4-[(1-phenylpyrrolidin-2-yl)methoxy]phenyl]propanoic acid |
| SMILES | COC(=O)c1ccccc1NC(Cc1ccc(OCC2CCCN2c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C28H30N2O5/c1-34-28(33)24-11-5-6-12-25(24)29-26(27(31)32)18-20-13-15-23(16-14-20)35-19-22-10-7-17-30(22)21-8-3-2-4-9-21/h2-6,8-9,11-16,22,26,29H,7,10,17-19H2,1H3,(H,31,32) |
| InChIKey | UNOADLLIDAEBJH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |