C14H20N4OS — CID 54363240
1-cyano-2-(2-methylbutan-2-yl)-3-(3-methylsulfinylphenyl)guanidine (PubChem CID 54363240) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 1-cyano-2-(2-methylbutan-2-yl)-3-(3-methylsulfinylphenyl)guanidine.
| Compound Name | 1-cyano-2-(2-methylbutan-2-yl)-3-(3-methylsulfinylphenyl)guanidine |
|---|---|
| PubChem CID | 54363240 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-cyano-2-(2-methylbutan-2-yl)-3-(3-methylsulfinylphenyl)guanidine |
| SMILES | CCC(C)(C)/N=C(\NC#N)Nc1cccc(S(C)=O)c1 |
| InChI | InChI=1S/C14H20N4OS/c1-5-14(2,3)18-13(16-10-15)17-11-7-6-8-12(9-11)20(4)19/h6-9H,5H2,1-4H3,(H2,16,17,18) |
| InChIKey | UNYSWQBZZCPJBU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|