C28H38N4O4 — CID 54363337
ethyl 2-[[2-amino-5-[N-[2-(cyclohexylmethylamino)-2-oxoethoxy]-C-(4-methylphenyl)carbonimidoyl]phenyl]methylamino]acetate (PubChem CID 54363337) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is ethyl 2-[[2-amino-5-[N-[2-(cyclohexylmethylamino)-2-oxoethoxy]-C-(4-methylphenyl)carbonimidoyl]phenyl]methylamino]acetate.
| Compound Name | ethyl 2-[[2-amino-5-[N-[2-(cyclohexylmethylamino)-2-oxoethoxy]-C-(4-methylphenyl)carbonimidoyl]phenyl]methylamino]acetate |
|---|---|
| PubChem CID | 54363337 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | ethyl 2-[[2-amino-5-[N-[2-(cyclohexylmethylamino)-2-oxoethoxy]-C-(4-methylphenyl)carbonimidoyl]phenyl]methylamino]acetate |
| SMILES | CCOC(=O)CNCc1cc(C(=NOCC(=O)NCC2CCCCC2)c2ccc(C)cc2)ccc1N |
| InChI | InChI=1S/C28H38N4O4/c1-3-35-27(34)18-30-17-24-15-23(13-14-25(24)29)28(22-11-9-20(2)10-12-22)32-36-19-26(33)31-16-21-7-5-4-6-8-21/h9-15,21,30H,3-8,16-19,29H2,1-2H3,(H,31,33) |
| InChIKey | UOAKSDXUHUMPFJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|