C25H31BrN4O4 — CID 173364231
2-[[2-amino-5-[C-(3-bromophenyl)-N-[2-(cyclohexylmethylamino)-2-oxoethoxy]carbonimidoyl]phenyl]methylamino]acetic acid (PubChem CID 173364231) has the molecular formula C25H31BrN4O4 and a molecular weight of 531.45 g/mol. Its IUPAC name is 2-[[2-amino-5-[C-(3-bromophenyl)-N-[2-(cyclohexylmethylamino)-2-oxoethoxy]carbonimidoyl]phenyl]methylamino]acetic acid.
| Compound Name | 2-[[2-amino-5-[C-(3-bromophenyl)-N-[2-(cyclohexylmethylamino)-2-oxoethoxy]carbonimidoyl]phenyl]methylamino]acetic acid |
|---|---|
| PubChem CID | 173364231 |
| Molecular Formula | C25H31BrN4O4 |
| Molecular Weight | 531.45 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 2-[[2-amino-5-[C-(3-bromophenyl)-N-[2-(cyclohexylmethylamino)-2-oxoethoxy]carbonimidoyl]phenyl]methylamino]acetic acid |
| SMILES | Nc1ccc(C(=NOCC(=O)NCC2CCCCC2)c2cccc(Br)c2)cc1CNCC(=O)O |
| InChI | InChI=1S/C25H31BrN4O4/c26-21-8-4-7-18(12-21)25(19-9-10-22(27)20(11-19)14-28-15-24(32)33)30-34-16-23(31)29-13-17-5-2-1-3-6-17/h4,7-12,17,28H,1-3,5-6,13-16,27H2,(H,29,31)(H,32,33) |
| InChIKey | PEYAVZQLUJMRNE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|