C16H10N2O — CID 54363780
4-(1,4-benzoxazin-2-ylidenemethyl)benzonitrile (PubChem CID 54363780) has the molecular formula C16H10N2O and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-(1,4-benzoxazin-2-ylidenemethyl)benzonitrile.
| Compound Name | 4-(1,4-benzoxazin-2-ylidenemethyl)benzonitrile |
|---|---|
| PubChem CID | 54363780 |
| Molecular Formula | C16H10N2O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-(1,4-benzoxazin-2-ylidenemethyl)benzonitrile |
| SMILES | N#Cc1ccc(C=C2C=Nc3ccccc3O2)cc1 |
| InChI | InChI=1S/C16H10N2O/c17-10-13-7-5-12(6-8-13)9-14-11-18-15-3-1-2-4-16(15)19-14/h1-9,11H |
| InChIKey | UOIKCVQXTKUQLH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |