About (4-hydroxyphenyl) 2-formylprop-2-enoate
(4-hydroxyphenyl) 2-formylprop-2-enoate (PubChem CID 54365742) has the molecular formula C10H8O4
and a molecular weight of 192.17 g/mol. Its IUPAC name is (4-hydroxyphenyl) 2-formylprop-2-enoate.
Molecular Properties
| Compound Name | (4-hydroxyphenyl) 2-formylprop-2-enoate |
| PubChem CID | 54365742 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | (4-hydroxyphenyl) 2-formylprop-2-enoate |
| SMILES | C=C(C=O)C(=O)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C10H8O4/c1-7(6-11)10(13)14-9-4-2-8(12)3-5-9/h2-6,12H,1H2 |
| InChIKey | UPQJQWMHTHRRJO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxyphenyl) 2-formylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxyphenyl) 2-formylprop-2-enoate?
The IUPAC name of (4-hydroxyphenyl) 2-formylprop-2-enoate (CID 54365742) is (4-hydroxyphenyl) 2-formylprop-2-enoate.
What is the SMILES notation for (4-hydroxyphenyl) 2-formylprop-2-enoate?
The canonical SMILES for (4-hydroxyphenyl) 2-formylprop-2-enoate is C=C(C=O)C(=O)Oc1ccc(O)cc1.
What is the InChIKey of (4-hydroxyphenyl) 2-formylprop-2-enoate?
The InChIKey is UPQJQWMHTHRRJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O4/c1-7(6-11)10(13)14-9-4-2-8(12)3-5-9/h2-6,12H,1H2.
What are the key properties of (4-hydroxyphenyl) 2-formylprop-2-enoate?
(4-hydroxyphenyl) 2-formylprop-2-enoate has a molecular weight of 192.17 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyphenyl) 2-formylprop-2-enoate is sourced from PubChem (CID 54365742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).