C34H35NO5 — CID 54369711
2-[2-[2-[4-(4-phenylmethoxyphenoxy)-2-propylphenoxy]ethyl]-1H-indol-5-yl]ethane-1,1-diol (PubChem CID 54369711) has the molecular formula C34H35NO5 and a molecular weight of 537.66 g/mol. Its IUPAC name is 2-[2-[2-[4-(4-phenylmethoxyphenoxy)-2-propylphenoxy]ethyl]-1H-indol-5-yl]ethane-1,1-diol.
| Compound Name | 2-[2-[2-[4-(4-phenylmethoxyphenoxy)-2-propylphenoxy]ethyl]-1H-indol-5-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 54369711 |
| Molecular Formula | C34H35NO5 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 2-[2-[2-[4-(4-phenylmethoxyphenoxy)-2-propylphenoxy]ethyl]-1H-indol-5-yl]ethane-1,1-diol |
| SMILES | CCCc1cc(Oc2ccc(OCc3ccccc3)cc2)ccc1OCCc1cc2cc(CC(O)O)ccc2[nH]1 |
| InChI | InChI=1S/C34H35NO5/c1-2-6-26-22-31(40-30-12-10-29(11-13-30)39-23-24-7-4-3-5-8-24)14-16-33(26)38-18-17-28-21-27-19-25(20-34(36)37)9-15-32(27)35-28/h3-5,7-16,19,21-22,34-37H,2,6,17-18,20,23H2,1H3 |
| InChIKey | USHHDMFTLPYFAZ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 83.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|