C28H31NO5 — CID 54435635
4-[4-[2-[5-(2-methylperoxyethyl)-1H-indol-2-yl]ethoxy]-3-propylphenoxy]phenol (PubChem CID 54435635) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is 4-[4-[2-[5-(2-methylperoxyethyl)-1H-indol-2-yl]ethoxy]-3-propylphenoxy]phenol.
| Compound Name | 4-[4-[2-[5-(2-methylperoxyethyl)-1H-indol-2-yl]ethoxy]-3-propylphenoxy]phenol |
|---|---|
| PubChem CID | 54435635 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 4-[4-[2-[5-(2-methylperoxyethyl)-1H-indol-2-yl]ethoxy]-3-propylphenoxy]phenol |
| SMILES | CCCc1cc(Oc2ccc(O)cc2)ccc1OCCc1cc2cc(CCOOC)ccc2[nH]1 |
| InChI | InChI=1S/C28H31NO5/c1-3-4-21-19-26(34-25-8-6-24(30)7-9-25)10-12-28(21)32-15-14-23-18-22-17-20(13-16-33-31-2)5-11-27(22)29-23/h5-12,17-19,29-30H,3-4,13-16H2,1-2H3 |
| InChIKey | WKNOHZCNELAULJ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|