About 3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one
3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one (PubChem CID 54369937) has the molecular formula C23H26N8O4
and a molecular weight of 478.51 g/mol. Its IUPAC name is 3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one.
Molecular Properties
| Compound Name | 3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one |
| PubChem CID | 54369937 |
| Molecular Formula | C23H26N8O4 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2cc(OCN3C=NNN3C)cc(OCN3C=NNN3C)c12 |
| InChI | InChI=1S/C23H26N8O4/c1-16-19(9-17-7-5-4-6-8-17)23(32)35-21-11-18(33-14-30-12-24-26-28(30)2)10-20(22(16)21)34-15-31-13-25-27-29(31)3/h4-8,10-13,26-27H,9,14-15H2,1-3H3 |
| InChIKey | USLJISJPLLBHJA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one?
The IUPAC name of 3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one (CID 54369937) is 3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one.
What is the SMILES notation for 3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one?
The canonical SMILES for 3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one is Cc1c(Cc2ccccc2)c(=O)oc2cc(OCN3C=NNN3C)cc(OCN3C=NNN3C)c12.
What is the InChIKey of 3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one?
The InChIKey is USLJISJPLLBHJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N8O4/c1-16-19(9-17-7-5-4-6-8-17)23(32)35-21-11-18(33-14-30-12-24-26-28(30)2)10-20(22(16)21)34-15-31-13-25-27-29(31)3/h4-8,10-13,26-27H,9,14-15H2,1-3H3.
What are the key properties of 3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one?
3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one has a molecular weight of 478.51 g/mol, XLogP of 1.59, 8 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-4-methyl-5,7-bis[(3-methyl-2H-tetrazol-4-yl)methoxy]chromen-2-one is sourced from PubChem (CID 54369937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).