C20H17ClN6S — CID 54371230
1-[3-[4-(3-chloroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-3-methylthiourea (PubChem CID 54371230) has the molecular formula C20H17ClN6S and a molecular weight of 408.92 g/mol. Its IUPAC name is 1-[3-[4-(3-chloroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-3-methylthiourea.
| Compound Name | 1-[3-[4-(3-chloroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-3-methylthiourea |
|---|---|
| PubChem CID | 54371230 |
| Molecular Formula | C20H17ClN6S |
| Molecular Weight | 408.92 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-[3-[4-(3-chloroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-3-methylthiourea |
| SMILES | CNC(=S)Nc1cccc(-c2cc3c(Nc4cccc(Cl)c4)ncnc3[nH]2)c1 |
| InChI | InChI=1S/C20H17ClN6S/c1-22-20(28)26-14-6-2-4-12(8-14)17-10-16-18(23-11-24-19(16)27-17)25-15-7-3-5-13(21)9-15/h2-11H,1H3,(H2,22,26,28)(H2,23,24,25,27) |
| InChIKey | UTIXVEICQYJJRY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.92 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|