C24H25N3O7S2 — CID 54372596
[1-ethyl-4-(4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)pyrazol-5-yl] 4-methylbenzenesulfonate (PubChem CID 54372596) has the molecular formula C24H25N3O7S2 and a molecular weight of 531.61 g/mol. Its IUPAC name is [1-ethyl-4-(4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)pyrazol-5-yl] 4-methylbenzenesulfonate.
| Compound Name | [1-ethyl-4-(4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)pyrazol-5-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54372596 |
| Molecular Formula | C24H25N3O7S2 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | [1-ethyl-4-(4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)pyrazol-5-yl] 4-methylbenzenesulfonate |
| SMILES | CCn1ncc(C(=O)c2ccc3c(c2C)C(=NOC)CCS3(=O)=O)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H25N3O7S2/c1-5-27-24(34-36(31,32)17-8-6-15(2)7-9-17)19(14-25-27)23(28)18-10-11-21-22(16(18)3)20(26-33-4)12-13-35(21,29)30/h6-11,14H,5,12-13H2,1-4H3 |
| InChIKey | UUGLNXUUSUBVMH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 133.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|