C20H25N3O6S3 — CID 22086192
[1-ethyl-4-[(4Z)-4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbothioyl]pyrazol-5-yl] propane-1-sulfonate (PubChem CID 22086192) has the molecular formula C20H25N3O6S3 and a molecular weight of 499.64 g/mol. Its IUPAC name is [1-ethyl-4-[(4Z)-4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbothioyl]pyrazol-5-yl] propane-1-sulfonate.
| Compound Name | [1-ethyl-4-[(4Z)-4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbothioyl]pyrazol-5-yl] propane-1-sulfonate |
|---|---|
| PubChem CID | 22086192 |
| Molecular Formula | C20H25N3O6S3 |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | [1-ethyl-4-[(4Z)-4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbothioyl]pyrazol-5-yl] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)Oc1c(C(=S)c2ccc3c(c2C)/C(=N\OC)CCS3(=O)=O)cnn1CC |
| InChI | InChI=1S/C20H25N3O6S3/c1-5-10-32(26,27)29-20-15(12-21-23(20)6-2)19(30)14-7-8-17-18(13(14)3)16(22-28-4)9-11-31(17,24)25/h7-8,12H,5-6,9-11H2,1-4H3/b22-16- |
| InChIKey | OOECAIVIQATWMZ-JWGURIENSA-N |
| XLogP | 2.62 |
| TPSA | 116.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|