C20H25N3O6S2 — CID 59876145
(4E)-2-ethyl-4-[[(4E)-4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl]-propylsulfonylmethylidene]pyrazol-3-one (PubChem CID 59876145) has the molecular formula C20H25N3O6S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is (4E)-2-ethyl-4-[[(4E)-4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl]-propylsulfonylmethylidene]pyrazol-3-one.
| Compound Name | (4E)-2-ethyl-4-[[(4E)-4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl]-propylsulfonylmethylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 59876145 |
| Molecular Formula | C20H25N3O6S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (4E)-2-ethyl-4-[[(4E)-4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl]-propylsulfonylmethylidene]pyrazol-3-one |
| SMILES | CCCS(=O)(=O)/C(=C1\C=NN(CC)C1=O)c1ccc2c(c1C)/C(=N/OC)CCS2(=O)=O |
| InChI | InChI=1S/C20H25N3O6S2/c1-5-10-31(27,28)19(15-12-21-23(6-2)20(15)24)14-7-8-17-18(13(14)3)16(22-29-4)9-11-30(17,25)26/h7-8,12H,5-6,9-11H2,1-4H3/b19-15+,22-16+ |
| InChIKey | NXQDASOYVSFELG-REQTXOKCSA-N |
| XLogP | 1.91 |
| TPSA | 122.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|