C17H24N4O5 — CID 54376718
tert-butyl 2-carbamimidoyl-6-[5-(2-methoxy-2-oxoethyl)-1,2-oxazolidin-3-yl]pyridine-3-carboxylate (PubChem CID 54376718) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is tert-butyl 2-carbamimidoyl-6-[5-(2-methoxy-2-oxoethyl)-1,2-oxazolidin-3-yl]pyridine-3-carboxylate.
| Compound Name | tert-butyl 2-carbamimidoyl-6-[5-(2-methoxy-2-oxoethyl)-1,2-oxazolidin-3-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 54376718 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | tert-butyl 2-carbamimidoyl-6-[5-(2-methoxy-2-oxoethyl)-1,2-oxazolidin-3-yl]pyridine-3-carboxylate |
| SMILES | [H]/N=C(\N)c1nc(C2CC(CC(=O)OC)ON2)ccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24N4O5/c1-17(2,3)25-16(23)10-5-6-11(20-14(10)15(18)19)12-7-9(26-21-12)8-13(22)24-4/h5-6,9,12,21H,7-8H2,1-4H3,(H3,18,19) |
| InChIKey | UXAHFCHMMYKWGZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 136.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|