C17H22N4O5 — CID 70068824
tert-butyl 2-carbamimidoyl-6-(5-propanoyloxy-4,5-dihydro-1,2-oxazol-3-yl)pyridine-3-carboxylate (PubChem CID 70068824) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is tert-butyl 2-carbamimidoyl-6-(5-propanoyloxy-4,5-dihydro-1,2-oxazol-3-yl)pyridine-3-carboxylate.
| Compound Name | tert-butyl 2-carbamimidoyl-6-(5-propanoyloxy-4,5-dihydro-1,2-oxazol-3-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 70068824 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | tert-butyl 2-carbamimidoyl-6-(5-propanoyloxy-4,5-dihydro-1,2-oxazol-3-yl)pyridine-3-carboxylate |
| SMILES | [H]/N=C(\N)c1nc(C2=NOC(OC(=O)CC)C2)ccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22N4O5/c1-5-12(22)24-13-8-11(21-26-13)10-7-6-9(14(20-10)15(18)19)16(23)25-17(2,3)4/h6-7,13H,5,8H2,1-4H3,(H3,18,19) |
| InChIKey | YTEPJOAOEJTXTA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 136.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|