C21H19BrN2O4S2 — CID 54377509
N-(5-bromo-2-pyridinyl)-2,2-bis-(4-methylphenyl)sulfonylethanimine (PubChem CID 54377509) has the molecular formula C21H19BrN2O4S2 and a molecular weight of 507.43 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2,2-bis-(4-methylphenyl)sulfonylethanimine.
| Compound Name | N-(5-bromo-2-pyridinyl)-2,2-bis-(4-methylphenyl)sulfonylethanimine |
|---|---|
| PubChem CID | 54377509 |
| Molecular Formula | C21H19BrN2O4S2 |
| Molecular Weight | 507.43 g/mol |
| Exact Mass | 506.00 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2,2-bis-(4-methylphenyl)sulfonylethanimine |
| SMILES | Cc1ccc(S(=O)(=O)C(/C=N/c2ccc(Br)cn2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H19BrN2O4S2/c1-15-3-8-18(9-4-15)29(25,26)21(14-24-20-12-7-17(22)13-23-20)30(27,28)19-10-5-16(2)6-11-19/h3-14,21H,1-2H3/b24-14+ |
| InChIKey | UXONYSHLASOHBF-ZVHZXABRSA-N |
| XLogP | 4.44 |
| TPSA | 93.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|