C33H27N3O8S4 — CID 54137238
2,2-bis(benzenesulfonyl)-N-[6-[2,2-bis(benzenesulfonyl)ethylideneamino]-2-pyridinyl]ethanimine (PubChem CID 54137238) has the molecular formula C33H27N3O8S4 and a molecular weight of 721.86 g/mol. Its IUPAC name is 2,2-bis(benzenesulfonyl)-N-[6-[2,2-bis(benzenesulfonyl)ethylideneamino]-2-pyridinyl]ethanimine.
| Compound Name | 2,2-bis(benzenesulfonyl)-N-[6-[2,2-bis(benzenesulfonyl)ethylideneamino]-2-pyridinyl]ethanimine |
|---|---|
| PubChem CID | 54137238 |
| Molecular Formula | C33H27N3O8S4 |
| Molecular Weight | 721.86 g/mol |
| Exact Mass | 721.07 |
| IUPAC Name | 2,2-bis(benzenesulfonyl)-N-[6-[2,2-bis(benzenesulfonyl)ethylideneamino]-2-pyridinyl]ethanimine |
| SMILES | O=S(=O)(c1ccccc1)C(C=Nc1cccc(/N=C/C(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)n1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C33H27N3O8S4/c37-45(38,26-14-5-1-6-15-26)32(46(39,40)27-16-7-2-8-17-27)24-34-30-22-13-23-31(36-30)35-25-33(47(41,42)28-18-9-3-10-19-28)48(43,44)29-20-11-4-12-21-29/h1-25,32-33H/b34-24+,35-25? |
| InChIKey | NYOYWSDMDSOKDU-OZZNBXDNSA-N |
| XLogP | 5.03 |
| TPSA | 174.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.86 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|