C16H19NO5S — CID 54377791
1-cyclopropyl-3-(4-methoxy-3-methylsulfonylphenyl)-2-(methyliminomethyl)propane-1,3-dione (PubChem CID 54377791) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is 1-cyclopropyl-3-(4-methoxy-3-methylsulfonylphenyl)-2-(methyliminomethyl)propane-1,3-dione.
| Compound Name | 1-cyclopropyl-3-(4-methoxy-3-methylsulfonylphenyl)-2-(methyliminomethyl)propane-1,3-dione |
|---|---|
| PubChem CID | 54377791 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1-cyclopropyl-3-(4-methoxy-3-methylsulfonylphenyl)-2-(methyliminomethyl)propane-1,3-dione |
| SMILES | C/N=C/C(C(=O)c1ccc(OC)c(S(C)(=O)=O)c1)C(=O)C1CC1 |
| InChI | InChI=1S/C16H19NO5S/c1-17-9-12(15(18)10-4-5-10)16(19)11-6-7-13(22-2)14(8-11)23(3,20)21/h6-10,12H,4-5H2,1-3H3/b17-9+ |
| InChIKey | UXTSUGXWKHSGDQ-RQZCQDPDSA-N |
| XLogP | 1.58 |
| TPSA | 89.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|