About S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate
S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate (PubChem CID 54388760) has the molecular formula C15H25NO2S
and a molecular weight of 283.44 g/mol. Its IUPAC name is S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate.
Molecular Properties
| Compound Name | S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate |
| PubChem CID | 54388760 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate |
| SMILES | CCCCCCCCNC(=O)C=CSC(=O)C1CC1 |
| InChI | InChI=1S/C15H25NO2S/c1-2-3-4-5-6-7-11-16-14(17)10-12-19-15(18)13-8-9-13/h10,12-13H,2-9,11H2,1H3,(H,16,17) |
| InChIKey | VFDATTXJHOISMC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate?
The IUPAC name of S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate (CID 54388760) is S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate.
What is the SMILES notation for S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate?
The canonical SMILES for S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate is CCCCCCCCNC(=O)C=CSC(=O)C1CC1.
What is the InChIKey of S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate?
The InChIKey is VFDATTXJHOISMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO2S/c1-2-3-4-5-6-7-11-16-14(17)10-12-19-15(18)13-8-9-13/h10,12-13H,2-9,11H2,1H3,(H,16,17).
What are the key properties of S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate?
S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate has a molecular weight of 283.44 g/mol, XLogP of 3.65, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[3-(octylamino)-3-oxoprop-1-enyl] cyclopropanecarbothioate is sourced from PubChem (CID 54388760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).