C20H26ClN5O2 — CID 54390352
N-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propyl]-4-(2,4-dimethylphenoxy)butanamide (PubChem CID 54390352) has the molecular formula C20H26ClN5O2 and a molecular weight of 403.91 g/mol. Its IUPAC name is N-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propyl]-4-(2,4-dimethylphenoxy)butanamide.
| Compound Name | N-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propyl]-4-(2,4-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 54390352 |
| Molecular Formula | C20H26ClN5O2 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propyl]-4-(2,4-dimethylphenoxy)butanamide |
| SMILES | Cc1ccc(OCCCC(=O)NCC(C)c2nc3c(Cl)c(C)[nH]n3n2)c(C)c1 |
| InChI | InChI=1S/C20H26ClN5O2/c1-12-7-8-16(13(2)10-12)28-9-5-6-17(27)22-11-14(3)19-23-20-18(21)15(4)24-26(20)25-19/h7-8,10,14,24H,5-6,9,11H2,1-4H3,(H,22,27) |
| InChIKey | UFOBNKAQAAYXQY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|