C28H34N2O7 — CID 54392941
3-[2-[benzyl-[2-hydroxy-3-[4-(2-methoxyethoxy)phenoxy]propyl]amino]ethoxy]-2-hydroxybenzamide (PubChem CID 54392941) has the molecular formula C28H34N2O7 and a molecular weight of 510.59 g/mol. Its IUPAC name is 3-[2-[benzyl-[2-hydroxy-3-[4-(2-methoxyethoxy)phenoxy]propyl]amino]ethoxy]-2-hydroxybenzamide.
| Compound Name | 3-[2-[benzyl-[2-hydroxy-3-[4-(2-methoxyethoxy)phenoxy]propyl]amino]ethoxy]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 54392941 |
| Molecular Formula | C28H34N2O7 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 3-[2-[benzyl-[2-hydroxy-3-[4-(2-methoxyethoxy)phenoxy]propyl]amino]ethoxy]-2-hydroxybenzamide |
| SMILES | COCCOc1ccc(OCC(O)CN(CCOc2cccc(C(N)=O)c2O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H34N2O7/c1-34-16-17-35-23-10-12-24(13-11-23)37-20-22(31)19-30(18-21-6-3-2-4-7-21)14-15-36-26-9-5-8-25(27(26)32)28(29)33/h2-13,22,31-32H,14-20H2,1H3,(H2,29,33) |
| InChIKey | VHYFEJRKZVWTPQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|