C27H32N2O4 — CID 70575623
5-[2-[benzyl-[2-hydroxy-4-(2-methylphenyl)butyl]amino]ethoxy]-2-hydroxybenzamide (PubChem CID 70575623) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is 5-[2-[benzyl-[2-hydroxy-4-(2-methylphenyl)butyl]amino]ethoxy]-2-hydroxybenzamide.
| Compound Name | 5-[2-[benzyl-[2-hydroxy-4-(2-methylphenyl)butyl]amino]ethoxy]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 70575623 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 5-[2-[benzyl-[2-hydroxy-4-(2-methylphenyl)butyl]amino]ethoxy]-2-hydroxybenzamide |
| SMILES | Cc1ccccc1CCC(O)CN(CCOc1ccc(O)c(C(N)=O)c1)Cc1ccccc1 |
| InChI | InChI=1S/C27H32N2O4/c1-20-7-5-6-10-22(20)11-12-23(30)19-29(18-21-8-3-2-4-9-21)15-16-33-24-13-14-26(31)25(17-24)27(28)32/h2-10,13-14,17,23,30-31H,11-12,15-16,18-19H2,1H3,(H2,28,32) |
| InChIKey | WMWFWPYVNRPMHE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |