C10H22N2O4 — CID 54393838
tert-butyl N-hydroxy-N-[5-(hydroxyamino)pentyl]carbamate (PubChem CID 54393838) has the molecular formula C10H22N2O4 and a molecular weight of 234.30 g/mol. Its IUPAC name is tert-butyl N-hydroxy-N-[5-(hydroxyamino)pentyl]carbamate.
| Compound Name | tert-butyl N-hydroxy-N-[5-(hydroxyamino)pentyl]carbamate |
|---|---|
| PubChem CID | 54393838 |
| Molecular Formula | C10H22N2O4 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | tert-butyl N-hydroxy-N-[5-(hydroxyamino)pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(O)CCCCCNO |
| InChI | InChI=1S/C10H22N2O4/c1-10(2,3)16-9(13)12(15)8-6-4-5-7-11-14/h11,14-15H,4-8H2,1-3H3 |
| InChIKey | VINURRBZGKMBGO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|