C18H21NO — CID 54398610
(6S)-6-(benzylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ol (PubChem CID 54398610) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is (6S)-6-(benzylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ol.
| Compound Name | (6S)-6-(benzylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ol |
|---|---|
| PubChem CID | 54398610 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (6S)-6-(benzylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ol |
| SMILES | Oc1ccc2c(c1)C[C@@H](NCc1ccccc1)CCC2 |
| InChI | InChI=1S/C18H21NO/c20-18-10-9-15-7-4-8-17(11-16(15)12-18)19-13-14-5-2-1-3-6-14/h1-3,5-6,9-10,12,17,19-20H,4,7-8,11,13H2/t17-/m0/s1 |
| InChIKey | VLUFOFDGSLZODF-KRWDZBQOSA-N |
| XLogP | 3.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |